Gartanin structure
|
Common Name | Gartanin | ||
|---|---|---|---|---|
| CAS Number | 33390-42-0 | Molecular Weight | 396.433 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 644.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9±25.0 °C | |
Use of GartaninGartanin is a natural xanthone of mangosteen, with antioxidant, anti-inflammatory, antifungal, neuroprotective and antineoplastic properties. Gartanin induces cell cycle arrest and autophagy and suppresses migration in human glioma cells[1][2]. |
| Name | gartanin |
|---|---|
| Synonym | More Synonyms |
| Description | Gartanin is a natural xanthone of mangosteen, with antioxidant, anti-inflammatory, antifungal, neuroprotective and antineoplastic properties. Gartanin induces cell cycle arrest and autophagy and suppresses migration in human glioma cells[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Gartanin is a potential agent against glutamate-induced oxidative injury partially through increasing Nrf-2-independed HO-1 and AMPK/SIRT1/PGC-1α signaling pathways [1]. Gartanin induces cell cycle arrest and autophagy and suppresses migration involving PI3K/Akt/mTOR and MAPK signalling pathway in human glioma cells [1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 644.4±55.0 °C at 760 mmHg |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.433 |
| Flash Point | 224.9±25.0 °C |
| Exact Mass | 396.157288 |
| PSA | 111.13000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | OJXQLGQIDIPMTE-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2oc3c(O)ccc(O)c3c(=O)c2c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
| Gartanin |
| 9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)- |
| 1,3,5,8-tetrahydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one |
| Gartinin |
| 1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| 9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-buten-1-yl)- |