cyanomethyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate
Modify Date: 2025-09-07 18:10:51
cyanomethyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate structure
|
Common Name | cyanomethyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 3338-35-0 | Molecular Weight | 338.35700 | |
| Density | 1.23g/cm3 | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
| Name | cyanomethyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760 mmHg |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.35700 |
| Flash Point | 293.5ºC |
| Exact Mass | 338.12700 |
| PSA | 91.91000 |
| LogP | 2.79528 |
| Index of Refraction | 1.571 |
| InChIKey | QDAFQGLLNQPQAT-UHFFFAOYSA-N |
| SMILES | N#CCOC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| HS Code | 2926909090 |
|---|
|
~%
cyanomethyl 3-p... CAS#:3338-35-0 |
| Literature: Sommer; Scher; Bien; Olsen; Chakrabarti; Friedman Journal of medicinal chemistry, 1966 , vol. 9, # 1 p. 84 - 88 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-benzyloxycarbonyl-phenylalanine cyanomethyl ester |
| N-Benzyloxycarbonylphenylalanincyanomethylester |
| ALANINE,N-BENZYLOXYCARBONYL-3-PHENYL-,CYANOMETHYL ESTER,DL |
| DL-N-Carbobenzoxy-phenylalanin-cyanmethylester |
| Z-DL-Phe-O-CH2CN |
| DL-N-Benzyloxycarbonyl-3-phenylalanine cyanomethyl ester |
| N-Benzyloxycarbonyl-phenylalanin-cyanmethylester |