PCB 7 structure
|
Common Name | PCB 7 | ||
|---|---|---|---|---|
| CAS Number | 33284-50-3 | Molecular Weight | 223.098 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 302.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Cl2 | Melting Point | 24.3°C | |
| MSDS | Chinese USA | Flash Point | 132.8±15.9 °C | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
| Name | 2,4-dichloro-1-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.3±22.0 °C at 760 mmHg |
| Melting Point | 24.3°C |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.098 |
| Flash Point | 132.8±15.9 °C |
| Exact Mass | 222.000305 |
| LogP | 5.04 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | WEJZHZJJXPXXMU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccccc2)c(Cl)c1 |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H373-H410 |
| Precautionary Statements | P273-P391-P501 |
| Hazard Codes | N: Dangerous for the environment; |
| Risk Phrases | R33 |
| Safety Phrases | 35-60-61 |
| RIDADR | UN 2315 |
| RTECS | DV3905000 |
| Packaging Group | II |
| HS Code | 2903999010 |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| PCB 7 |
| 1,1'-Biphenyl,2,4-dichloro |
| Biphenyl,2,4-dichloro |
| 2,4-diichlorobiphenyl |
| 2,4-PCB |
| 2,4-Dichloro-1,1'-biphenyl |
| 2,4-chlorobiphenyl |
| 2,3-Dichlorobiphenyl |
| 1,1'-Biphenyl, 2,4-dichloro- |
| 2,4-Dichlorobiphenyl |
| 2,3,6-TRICHLOROBIPHENYL |
| PCB No 7 |