4-BOC-1-(6-BROMO-2-PYRIDYL)PIPERAZINE structure
|
Common Name | 4-BOC-1-(6-BROMO-2-PYRIDYL)PIPERAZINE | ||
|---|---|---|---|---|
| CAS Number | 331767-56-7 | Molecular Weight | 342.232 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 445.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20BrN3O2 | Melting Point | 94-98ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 223.1±28.7 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | tert-butyl 4-(6-bromopyridin-2-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.3±45.0 °C at 760 mmHg |
| Melting Point | 94-98ºC(lit.) |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.232 |
| Flash Point | 223.1±28.7 °C |
| Exact Mass | 341.073883 |
| PSA | 45.67000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | CQSAPHUUCUUHNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(Br)n2)CC1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Safety Phrases | 36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate |
| tert-Butyl 4-(6-bromopyridin-2-yl)piperazine-1-carboxylate |
| 1-Piperazinecarboxylic acid, 4-(6-bromo-2-pyridinyl)-, 1,1-dimethylethyl ester |