3(2H)-Pyridazinone, 6-(dimethylamino)-2-phenyl- structure
|
Common Name | 3(2H)-Pyridazinone, 6-(dimethylamino)-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 32929-22-9 | Molecular Weight | 215.25100 | |
| Density | 1.12g/cm3 | Boiling Point | 325.9ºC at 760 mmHg | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.9ºC | |
| Name | 6-(dimethylamino)-2-phenylpyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 325.9ºC at 760 mmHg |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.25100 |
| Flash Point | 150.9ºC |
| Exact Mass | 215.10600 |
| PSA | 38.13000 |
| LogP | 1.29850 |
| Index of Refraction | 1.588 |
| InChIKey | OGGVYFZQKOAMSL-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(=O)n(-c2ccccc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-dimethylamino-2-phenyl-2H-pyridazin-3-one |