4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one structure
|
Common Name | 4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 3707-98-0 | Molecular Weight | 249.69600 | |
| Density | 1.24g/cm3 | Boiling Point | 321ºC at 760 mmHg | |
| Molecular Formula | C12H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9ºC | |
| Name | 4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 321ºC at 760 mmHg |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.69600 |
| Flash Point | 147.9ºC |
| Exact Mass | 249.06700 |
| PSA | 38.13000 |
| LogP | 1.95190 |
| Index of Refraction | 1.604 |
| InChIKey | HMJHBWNOBINIKP-UHFFFAOYSA-N |
| SMILES | CN(C)c1cnn(-c2ccccc2)c(=O)c1Cl |
| HS Code | 2933990090 |
|---|
|
~28%
4-chloro-5-(dim... CAS#:3707-98-0 |
| Literature: Konecny, Vaclav; Kovac, Stefan; Varkonda, Stefan Collection of Czechoslovak Chemical Communications, 1985 , vol. 50, # 2 p. 492 - 502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-4-chloro-5-dimethylaminopyridazin-3-one |
| Sandoz 9785 |
| 4-chloro-5-(dimethylamino)-2-phenyl-3(2H)-pyridazinone |
| San-9785 |
| 4-Chloro-5-dimethylamino-2-phenyl-2H-pyridazin-3-one |
| 5-dimethylamino-4-chloro-2-phenyl-3(2H)-pyridazinone |