N-1,1''-BIPHENYL-4-YL-2-CHLOROACETAMIDE structure
|
Common Name | N-1,1''-BIPHENYL-4-YL-2-CHLOROACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 3289-77-8 | Molecular Weight | 245.70400 | |
| Density | 1.233g/cm3 | Boiling Point | 448.4ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
| Name | 2-chloro-N-(4-phenylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760mmHg |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 225ºC |
| Exact Mass | 245.06100 |
| PSA | 29.10000 |
| LogP | 3.60390 |
| Index of Refraction | 1.619 |
| InChIKey | IDXDZLUJUXGKJZ-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(-c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-biphenyl-4-yl-2-chloroacetamide |
| HMS2684A18 |
| Chlor-essigsaeure-biphenyl-4-ylamid |
| chloro-acetic acid biphenyl-4-ylamide |
| N-1,1'-biphenyl-4-yl-2-chloroacetamide |
| 4-Phenyl-chloroacetoanilid |
| N-(4-Biphenylyl)-chloracetamid |