9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one
Modify Date: 2025-08-24 23:50:32
9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one structure
|
Common Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 328546-65-2 | Molecular Weight | 207.18600 | |
| Density | 1.341g/cm3 | Boiling Point | 516.9ºC at 760mmHg | |
| Molecular Formula | C9H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.4ºC | |
| Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 516.9ºC at 760mmHg |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.18600 |
| Flash Point | 266.4ºC |
| Exact Mass | 207.06400 |
| PSA | 86.95000 |
| LogP | 1.74010 |
| Index of Refraction | 1.585 |
| InChIKey | ZSLHWCFNYIEQJJ-UHFFFAOYSA-N |
| SMILES | O=C1NCCNc2c1cccc2[N+](=O)[O-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Nitro-1,2,3,4-tetrahydro-5H-1,4-benzodiazepin-5-one |
| 2,3,4,5-tetrahydro-9-nitro-1H-1,4-benzodiazepin-5-one |