METHYL4-AMINO-3,5-DIBROMOBENZOATE structure
|
Common Name | METHYL4-AMINO-3,5-DIBROMOBENZOATE | ||
|---|---|---|---|---|
| CAS Number | 3282-10-8 | Molecular Weight | 308.95500 | |
| Density | 1.907g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C8H7Br2NO2 | Melting Point | 102-104ºC | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | methyl 4-amino-3,5-dibromobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.907g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Melting Point | 102-104ºC |
| Molecular Formula | C8H7Br2NO2 |
| Molecular Weight | 308.95500 |
| Flash Point | 173ºC |
| Exact Mass | 306.88400 |
| PSA | 52.32000 |
| LogP | 3.16160 |
| Index of Refraction | 1.63 |
| InChIKey | CEKVGQOFHYOXSE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)c(N)c(Br)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922499990 |
|
~10%
METHYL4-AMINO-3... CAS#:3282-10-8 |
| Literature: Nicolaou; Li, Hui; Boddy, Christopher N. C.; Ramanjulu, Joshi M.; Yue, Tai-Yuen; Natarajan, Swaminathan; Chu, Xin-Jie; Braese, Stefan; Ruebsam, Frank Chemistry - A European Journal, 1999 , vol. 5, # 9 p. 2584 - 2601 |
|
~%
METHYL4-AMINO-3... CAS#:3282-10-8 |
| Literature: Chemistry - A European Journal, , vol. 5, # 9 p. 2584 - 2601 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 3,5-dibromo-4-aminobenzoate |
| OR6765 |
| 4-Amino-3,5-dibrom-benzoesaeure-methylester |
| 3,5-Dibrom-4-aminobenzoesaeuremethylester |
| 4-amino-3,5-dibromo-benzoic acid methyl ester |