sodium,methyl (4-nitrophenyl) phosphate
Modify Date: 2025-09-12 16:26:22
sodium,methyl (4-nitrophenyl) phosphate structure
|
Common Name | sodium,methyl (4-nitrophenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 32586-84-8 | Molecular Weight | 255.09700 | |
| Density | N/A | Boiling Point | 379.2ºC at 760 mmHg | |
| Molecular Formula | C7H7NNaO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | sodium,methyl (4-nitrophenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 379.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H7NNaO6P |
| Molecular Weight | 255.09700 |
| Flash Point | 183.2ºC |
| Exact Mass | 254.99100 |
| PSA | 114.22000 |
| LogP | 2.68180 |
| InChIKey | WAINOIDVYAUWFZ-UHFFFAOYSA-M |
| SMILES | COP(=O)([O-])Oc1ccc([N+](=O)[O-])cc1.[Na+] |
|
~%
sodium,methyl (... CAS#:32586-84-8 |
| Literature: Tsao, Belinda L.; Pieters, Roland J.; Rebek Jr., Julius Journal of the American Chemical Society, 1995 , vol. 117, # 8 p. 2210 - 2213 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| sodium methyl p-nitrophenyl phosphate |
| sodium methyl 4-nitrophenyl phosphate |