N-Benzyl-3-(tert-butyldimethylsilanyloxymethyl)piperid-4-one structure
|
Common Name | N-Benzyl-3-(tert-butyldimethylsilanyloxymethyl)piperid-4-one | ||
|---|---|---|---|---|
| CAS Number | 325486-37-1 | Molecular Weight | 333.54000 | |
| Density | 0.997g/cm3 | Boiling Point | 397.685ºC at 760 mmHg | |
| Molecular Formula | C19H31NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.313ºC | |
| Name | 1-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-4-one |
|---|
| Density | 0.997g/cm3 |
|---|---|
| Boiling Point | 397.685ºC at 760 mmHg |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.54000 |
| Flash Point | 194.313ºC |
| Exact Mass | 333.21200 |
| PSA | 29.54000 |
| LogP | 4.03730 |
| Index of Refraction | 1.503 |
| InChIKey | WOYQEVXRQBRUAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CN(Cc2ccccc2)CCC1=O |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933399090 |
|
~60%
N-Benzyl-3-(ter... CAS#:325486-37-1 |
| Literature: ELI LILLY AND COMPANY Patent: EP1204659 B1, 2003 ; Location in patent: Page/Page column 28 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |