CAY10567
Modify Date: 2025-08-26 11:43:26
CAY10567 structure
|
Common Name | CAY10567 | ||
|---|---|---|---|---|
| CAS Number | 32387-96-5 | Molecular Weight | 326.348 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 493.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H14N2O2 | Melting Point | 292-294ºC | |
| MSDS | N/A | Flash Point | 252.2±27.3 °C | |
| Name | 2,3-diphenylquinoxaline-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.4±40.0 °C at 760 mmHg |
| Melting Point | 292-294ºC |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.348 |
| Flash Point | 252.2±27.3 °C |
| Exact Mass | 326.105530 |
| PSA | 63.08000 |
| LogP | 3.97 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | LFWGZXMTCUOPFI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~99%
CAY10567 CAS#:32387-96-5 |
| Literature: Roubinek; Bydzovsky; Budesinsky Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 1 p. 285 - 294 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Diphenyl-6-quinoxalinecarboxylic acid |
| 2,3-Diphenyl-quinoxaline-6-carboxylic acid |
| 6-Quinoxalinecarboxylic acid, 2,3-diphenyl- |
| 2,3-Diphenylquinoxaline-6-carboxylic Acid |
| 6-carboxylic acid-2,3-diphenylquinoxaline |
| 2,3-Diphenyl-chinoxalin-6-carbonsaeure |
| 6-Quinoxalinecarboxylic acid,2,3-diphenyl |