2-phenylethyl benzenesulfonate structure
|
Common Name | 2-phenylethyl benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 32376-95-7 | Molecular Weight | 262.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylethyl benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O3S |
|---|---|
| Molecular Weight | 262.32400 |
| Exact Mass | 262.06600 |
| PSA | 51.75000 |
| LogP | 3.71540 |
| InChIKey | LVAVWJHMTPWHSU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCCc1ccccc1)c1ccccc1 |
|
~%
2-phenylethyl b... CAS#:32376-95-7 |
| Literature: Crich; Filzen Tetrahedron Letters, 1993 , vol. 34, # 20 p. 3225 - 3226 |
|
~%
2-phenylethyl b... CAS#:32376-95-7 |
| Literature: Yoh, Soo-Dong; Park, Jong-Hwan; Lee, Kyung-A; Han, In-Sook Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 3 p. 1149 - 1152 |
| 2-phenylethyl benzenesulphonate |
| phenylethyl benzenesulfonate |
| benzenesulfonic acid phenethyl ester |
| 2-phenethyl benzenesulfonate |
| Benzenesulfonic acid,2-phenylethyl ester |
| phenethyl benzenesulfonate |
| Benzolsulfonsaeurephenaethylester |