4-[(4-dimethylaminophenyl)methylideneamino]phenol structure
|
Common Name | 4-[(4-dimethylaminophenyl)methylideneamino]phenol | ||
|---|---|---|---|---|
| CAS Number | 3230-38-4 | Molecular Weight | 240.30000 | |
| Density | 1.05g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | 4-[[4-(dimethylamino)phenyl]methylideneamino]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 214.4ºC |
| Exact Mass | 240.12600 |
| PSA | 35.83000 |
| LogP | 3.20880 |
| Index of Refraction | 1.562 |
| InChIKey | CRCUEIAXNOGFFZ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=Nc2ccc(O)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-dimethylaminobenzaldehyde adduct of 4-aminophenol |