1-phenyl-3-(trifluoromethyl)-2-pyrazolin-5-one structure
|
Common Name | 1-phenyl-3-(trifluoromethyl)-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 321-07-3 | Molecular Weight | 228.17100 | |
| Density | 1.39g/cm3 | Boiling Point | 278.7ºC at 760mmHg | |
| Molecular Formula | C10H7F3N2O | Melting Point | 195-196°C | |
| MSDS | USA | Flash Point | 122.3ºC | |
| Name | 2-phenyl-5-(trifluoromethyl)-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 278.7ºC at 760mmHg |
| Melting Point | 195-196°C |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17100 |
| Flash Point | 122.3ºC |
| Exact Mass | 228.05100 |
| PSA | 32.67000 |
| LogP | 1.84220 |
| Index of Refraction | 1.543 |
| InChIKey | GLGRRRKQSFURGD-UHFFFAOYSA-N |
| SMILES | O=C1CC(C(F)(F)F)=NN1c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
|
~96%
1-phenyl-3-(tri... CAS#:321-07-3 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 45, # 5 p. 1315 - 1318 |
|
~85%
1-phenyl-3-(tri... CAS#:321-07-3 |
| Literature: Tetrahedron, , vol. 65, # 13 p. 2660 - 2668 |
| 1-phenyl-3-trifluoromethyl-5-pyrazolone |
| 3-trifluoromethyl-1-phenyl-2-pyrazolin-5-one |
| 3-triuoromethyl-1-phenyl-2-pyrazolin-5-one |
| 1-Phenyl-3-trifluoromethyl-2-pyrazolin-5-one |
| MFCD00051655 |