2-Dimethoxymethyl-quinoxaline 1,4-dioxide structure
|
Common Name | 2-Dimethoxymethyl-quinoxaline 1,4-dioxide | ||
|---|---|---|---|---|
| CAS Number | 32065-66-0 | Molecular Weight | 236.224 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 401.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.5±31.5 °C | |
| Name | 3-(dimethoxymethyl)-4-oxidoquinoxalin-1-ium 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.2±55.0 °C at 760 mmHg |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.224 |
| Flash Point | 196.5±31.5 °C |
| Exact Mass | 236.079712 |
| PSA | 69.38000 |
| LogP | -0.79 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | BWTLITYWRKJWIM-UHFFFAOYSA-N |
| SMILES | COC(OC)c1c[n+](=O)c2ccccc2n1[O-] |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-formylquinoxaline-1,4-dioxide dimethylacetal |
| 2-(Dimethoxymethyl)quinoxaline 1,4-dioxide |
| quinoxaline-di-N-oxide-2-carboxyaldehyde dimethylacetal |
| 2-Formylchinoxalin-N1,N4-dioxyddimethylacetal |
| CH-650-2 |
| Quinoxaline, 2-(dimethoxymethyl)-, 1,4-dioxide |
| 2-Dimethoxymethyl-quinoxaline 1,4-dioxide |
| Quinoxaline,2-(dimethoxymethyl)-,1,4-dioxide |
| EINECS 250-910-9 |
| 2-Formylquinoxaline-di-N-oxide dimethylacetal |