8-benzyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.4.0]deca-1,3,5-trien-7- one structure
|
Common Name | 8-benzyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.4.0]deca-1,3,5-trien-7- one | ||
|---|---|---|---|---|
| CAS Number | 31846-50-1 | Molecular Weight | 287.33400 | |
| Density | 1.376g/cm3 | Boiling Point | 489.3ºC at 760mmHg | |
| Molecular Formula | C15H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | 3-benzyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 489.3ºC at 760mmHg |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.33400 |
| Flash Point | 249.7ºC |
| Exact Mass | 287.06200 |
| PSA | 62.83000 |
| LogP | 3.19110 |
| Index of Refraction | 1.65 |
| InChIKey | XUERUNOIASVRRR-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2CS(=O)(=O)N1Cc1ccccc1 |
| HS Code | 2914399090 |
|---|
|
~%
8-benzyl-9,9-di... CAS#:31846-50-1 |
| Literature: Sianesi; Redaelli; Magistretti; Massarani Journal of Medicinal Chemistry, 1973 , vol. 16, # 10 p. 1133 - 1137 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-Benzyl-3,4-dihydro-4-oxo-1H-2,3-benzothiazin-S-dioxid |