2-bromo-2-methyl-1-(1-methylindol-3-yl)propan-1-one
Modify Date: 2025-09-16 10:51:38
2-bromo-2-methyl-1-(1-methylindol-3-yl)propan-1-one structure
|
Common Name | 2-bromo-2-methyl-1-(1-methylindol-3-yl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 31806-55-0 | Molecular Weight | 280.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-2-methyl-1-(1-methylindol-3-yl)propan-1-one |
|---|
| Molecular Formula | C13H14BrNO |
|---|---|
| Molecular Weight | 280.16000 |
| Exact Mass | 279.02600 |
| PSA | 22.00000 |
| LogP | 3.53450 |
| InChIKey | GQQQYZCTJSDYOZ-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)C(C)(C)Br)c2ccccc21 |
|
~%
2-bromo-2-methy... CAS#:31806-55-0 |
| Literature: Sanchez, Joseph P.; Parcell, Robert F. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 469 - 474 |
|
~%
2-bromo-2-methy... CAS#:31806-55-0 |
| Literature: Sanchez, Joseph P.; Parcell, Robert F. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 469 - 474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |