4-(4-(5-Mercapto-1,3,4-oxadiazol-2-yl)phenyl) thioseMicarbazide structure
|
Common Name | 4-(4-(5-Mercapto-1,3,4-oxadiazol-2-yl)phenyl) thioseMicarbazide | ||
|---|---|---|---|---|
| CAS Number | 317337-07-8 | Molecular Weight | 267.33 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 452.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H9N5OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6±31.5 °C | |
Use of 4-(4-(5-Mercapto-1,3,4-oxadiazol-2-yl)phenyl) thioseMicarbazideStemazole is a protective agent that promotes stem cell survival. Stemazole has the protective effect of human embryonic stem cells (hESCs). Stemazole enhances clonal expansion of single cells and decreases apoptosis. Stemazole for the study of stem cell survival in starvation culture [1]. |
| Name | stemazole |
|---|---|
| Synonym | More Synonyms |
| Description | Stemazole is a protective agent that promotes stem cell survival. Stemazole has the protective effect of human embryonic stem cells (hESCs). Stemazole enhances clonal expansion of single cells and decreases apoptosis. Stemazole for the study of stem cell survival in starvation culture [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.7±55.0 °C at 760 mmHg |
| Molecular Formula | C9H9N5OS2 |
| Molecular Weight | 267.33 |
| Flash Point | 227.6±31.5 °C |
| Exact Mass | 267.024841 |
| PSA | 159.89000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.762 |
| InChIKey | DSZWZHYEFYRNQI-UHFFFAOYSA-N |
| SMILES | NNC(=S)Nc1ccc(-c2n[nH]c(=S)o2)cc1 |
| 4-(4-(5-mercapto-1,3,4-oxadiazol-2-yl)phenyl) semicarbazide |
| hydrazino-4-(5-sulfanyl-1,3,4-oxadiazol-2-yl)anilinomethanethione |
| Hydrazinecarbothioamide, N-[4-(4,5-dihydro-5-thioxo-1,3,4-oxadiazol-2-yl)phenyl]- |
| 4-(4-(5-mercapto-1,3,4-oxadiazol-2-yl)phenyl)thiosemicarbazide |
| 4-(4-(5-mercapto-1,3,4-oxadiazol-2-yl)phenyl) thiosemicarbazide |
| N-[4-(5-Thioxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)phenyl]hydrazinecarbothioamide |