Benzamide,N-[2-amino-2-oxo-1-(phenylthio)ethyl]- structure
|
Common Name | Benzamide,N-[2-amino-2-oxo-1-(phenylthio)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 31666-19-0 | Molecular Weight | 286.34900 | |
| Density | 1.3g/cm3 | Boiling Point | 541.5ºC at 760mmHg | |
| Molecular Formula | C15H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | N-(2-amino-2-oxo-1-phenylsulfanylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 541.5ºC at 760mmHg |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.34900 |
| Flash Point | 281.3ºC |
| Exact Mass | 286.07800 |
| PSA | 97.49000 |
| LogP | 3.11130 |
| Index of Refraction | 1.657 |
| InChIKey | GFQJOWOFPRNYSE-UHFFFAOYSA-N |
| SMILES | NC(=O)C(NC(=O)c1ccccc1)Sc1ccccc1 |
|
~%
Benzamide,N-[2-... CAS#:31666-19-0 |
| Literature: Shah; Lam; Ketcham Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 456 - 458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoylamino-phenylmercapto-essigsaeure-amid |