Benzamide,N-[2-amino-2-oxo-1-[(phenylmethyl)thio]ethyl]- structure
|
Common Name | Benzamide,N-[2-amino-2-oxo-1-[(phenylmethyl)thio]ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 31657-20-2 | Molecular Weight | 300.37500 | |
| Density | 1.258g/cm3 | Boiling Point | 550.2ºC at 760mmHg | |
| Molecular Formula | C16H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.5ºC | |
| Name | N-(2-amino-1-benzylsulfanyl-2-oxoethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 550.2ºC at 760mmHg |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.37500 |
| Flash Point | 286.5ºC |
| Exact Mass | 300.09300 |
| PSA | 97.49000 |
| LogP | 3.25240 |
| Index of Refraction | 1.632 |
| InChIKey | QDQWKLNQYZGFCX-UHFFFAOYSA-N |
| SMILES | NC(=O)C(NC(=O)c1ccccc1)SCc1ccccc1 |
|
~%
Benzamide,N-[2-... CAS#:31657-20-2 |
| Literature: Shah; Lam; Ketcham Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 456 - 458 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzoylamino-benzylmercapto-essigsaeure-amid |