3,3-bis(3-methylbut-2-enyl)chromene-2,4-dione
Modify Date: 2025-08-26 17:46:29
3,3-bis(3-methylbut-2-enyl)chromene-2,4-dione structure
|
Common Name | 3,3-bis(3-methylbut-2-enyl)chromene-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 31581-56-3 | Molecular Weight | 298.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-bis(3-methylbut-2-enyl)chromene-2,4-dione |
|---|
| Molecular Formula | C19H22O3 |
|---|---|
| Molecular Weight | 298.37600 |
| Exact Mass | 298.15700 |
| PSA | 43.37000 |
| LogP | 4.48730 |
| InChIKey | NKZIZALQNYPKQA-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)Oc2ccccc2C1=O |
|
~35%
3,3-bis(3-methy... CAS#:31581-56-3 |
| Literature: Majumdar; Khan; Chattopadhyay Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 5 p. 483 - 485 |
|
~%
3,3-bis(3-methy... CAS#:31581-56-3 |
| Literature: Garro Hugo; Manzur Jimena; Ciuffo Gladys; Tonn Carlos; Pungitore Carlos Bioorganic and Medicinal Chemistry Letters, 2014 , vol. 24, # 3 p. 760 - 764 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |