Benzeneacetic acid,2-chloro-a-(2-chlorophenyl)-a-hydroxy-
Modify Date: 2025-08-25 15:23:25
Benzeneacetic acid,2-chloro-a-(2-chlorophenyl)-a-hydroxy- structure
|
Common Name | Benzeneacetic acid,2-chloro-a-(2-chlorophenyl)-a-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 3152-12-3 | Molecular Weight | 297.13300 | |
| Density | 1.469g/cm3 | Boiling Point | 480.6ºC at 760mmHg | |
| Molecular Formula | C14H10Cl2O3 | Melting Point | 160-164ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 244.4ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2,2-bis(2-chlorophenyl)-2-hydroxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 480.6ºC at 760mmHg |
| Melting Point | 160-164ºC(lit.) |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.13300 |
| Flash Point | 244.4ºC |
| Exact Mass | 296.00100 |
| PSA | 57.53000 |
| LogP | 3.31390 |
| Index of Refraction | 1.637 |
| InChIKey | OJYHUFNZIWRMPT-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(c1ccccc1Cl)c1ccccc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2918199090 |
|
~99%
Benzeneacetic a... CAS#:3152-12-3 |
| Literature: Journal of Chemical Research - Part S, , # 1 p. 62 - 63 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2.2'-Dichlor-benzilsaeure |
| MFCD00049233 |
| 2,2'-DIAMINO DIPHENYL SULFIDE |
| 2,2′-Dichlorobenzilic acid |
| 2,2'-dichloro-benzilic acid |