Bromacil structure
|
Common Name | Bromacil | ||
|---|---|---|---|---|
| CAS Number | 314-40-9 | Molecular Weight | 261.116 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 411ºC | |
| Molecular Formula | C9H13BrN2O2 | Melting Point | 157-160°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | bromacil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 411ºC |
| Melting Point | 157-160°C |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.116 |
| Exact Mass | 260.016022 |
| PSA | 54.86000 |
| LogP | 2.10 |
| Index of Refraction | 1.541 |
| InChIKey | CTSLUCNDVMMDHG-UHFFFAOYSA-N |
| SMILES | CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O |
| Stability | Stable. Incompatible with strong acids, strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | S26-S61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | YQ9100000 |
| HS Code | 2933599014 |
| HS Code | 2933599014 |
|---|---|
| Summary | 2933599014 6-nitroso-7h-purine。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Toxicity of the herbicides bromacil and simazine to the aquatic macrophyte, Vallisneria americana Michx.
Environ. Toxicol. Chem. 29(1) , 201-11, (2010) Vallisneria americana Michx. (tapegrass) is an ecologically important submersed, vascular aquatic plant that provides food and shelter for many aquatic and waterfowl species. This plant often occurs c... |
|
|
Determination of selected herbicides and phenols in water and soils by solid-phase extraction and high-performance liquid chromatography.
J. Chromatogr. Sci. 38(5) , 211-8, (2000) A high-performance liquid chromatography procedure or the determination of the herbicides simazine, propazine, bromacil, metoxuron, and hexazinone is elaborated. Stationary phases RP8 and RP18 and mix... |
|
|
Combined photobacterium toxicity of herbicide mixtures containing one insecticide.
Chemosphere 75(3) , 381-8, (2009) To test whether the dose-addition (DA) model can predict the combined toxicity of the mixtures of herbicides that coexisted with insecticide(s), we selected five herbicides (simetryn, prometon, bromac... |
| 5-Bromo-3-(sec-butyl)-6-methylpyrimidine-2,4(1H,3H)-dione |
| 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione |
| Uragon |
| 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
| Urox B |
| hibor |
| EINECS 206-245-1 |
| 5-Br |
| 5-Brom-3-(butan-2-yl)-6-methylpyrimidin-2,4(1H,3H)-dion |
| 5-Bromo-3-sec-butyl-6-methyl-2,4(1H,3H)-pyrimidinedione |
| (RS)-5-bromo-3-sec-butyl-6-methyluracil |
| Nalkil |
| Borea |
| 5-bromo-6-methyl-3-(1-methylpropyl)-2,4(1H,3H)-pyrimidinedione |
| 5-bromo-3-s-butyl-6-methyluracil |
| Rout |
| Bromax |
| 5-Bromo-3-sec.-butyl-6-methyluracil |
| 5-Brom-3-sec-butyl-6-methylpyrimidin-2,4(1H,3H)-dion |
| 5-Bromo-3-sec-butyl-6-methyluracil |
| 5-Bromo-3-sec-butyl-6-methylpyrimidine-2,4(1H,3H)-dione |
| rac-(3R)-5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione |
| T6MVNVJ CY2&1 EE F1 |
| MFCD00055364 |
| Bromacil |
| Hyvar |
| 5-bromo-6-methyl-3-(1-methylpropyl)pyrimidine-2,4(1H,3H)-dione |