LUTROL (R) OP 2000 structure
|
Common Name | LUTROL (R) OP 2000 | ||
|---|---|---|---|---|
| CAS Number | 31394-71-5 | Molecular Weight | 340.54100 | |
| Density | 0.92g/cm3 | Boiling Point | 421.4ºC at 760 mmHg | |
| Molecular Formula | C21H40O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 154.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-hydroxypropyl (E)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760 mmHg |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.54100 |
| Flash Point | 154.1ºC |
| Exact Mass | 340.29800 |
| PSA | 46.53000 |
| LogP | 5.94950 |
| Index of Refraction | 1.467 |
| InChIKey | YWBLIYFXWVRDAA-MDZDMXLPSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCCO |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| Polyoxypropylene (26) monooleate |
| Polyoxypropylene (36) monooleate |
| Polyoxypropylene oleate |
| Polypropylene glycol (36) monooleate |
| Polypropylene glycol (26) monooleate |
| PPG-36 Oleate |
| PPG-26 Oleate |
| Oleic acid,3-hydroxypropyl ester |