1,10-Phenanthroline-4,7-dicarboxylic acid structure
|
Common Name | 1,10-Phenanthroline-4,7-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 31301-31-2 | Molecular Weight | 268.22400 | |
| Density | 1.585 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H8N2O4 | Melting Point | >300℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,10-Phenanthroline-4,7-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585 g/cm3 |
|---|---|
| Melting Point | >300℃ |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Exact Mass | 268.04800 |
| PSA | 100.38000 |
| LogP | 2.17940 |
| InChIKey | MBOIBXSDCWRKJR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccnc2c1ccc1c(C(=O)O)ccnc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
1,10-Phenanthro... CAS#:31301-31-2 |
| Literature: Borieha, Vinod P.; Patra, Subrata; Chouhan, Yogendra S.; Sanavada, Pankaj; Suresh; Paul, Parimal European Journal of Inorganic Chemistry, 2009 , # 9 p. 1256 - 1267 |
|
~42%
1,10-Phenanthro... CAS#:31301-31-2 |
| Literature: Yanagida, Masatoshi Journal of the Chemical Society, Dalton Transactions, 2000 , # 16 p. 2817 - 2822 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-dicarboxy-1,10-phenantroline |
| 4,7-dicarboxy-1,10-phenanthroline |
| 1,10-phenantholine-4,7-dicarboxylic acid |
| 1,10-phenantrilone-4,7-dicarboxylic acid |