2-(1H-INDOL-3-YL)-ETHYL]-THIOUREA structure
|
Common Name | 2-(1H-INDOL-3-YL)-ETHYL]-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 312751-53-4 | Molecular Weight | 219.30600 | |
| Density | 1.3g/cm3 | Boiling Point | 448.3ºC at 760mmHg | |
| Molecular Formula | C11H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | 2-(1H-indol-3-yl)ethylthiourea |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 448.3ºC at 760mmHg |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.30600 |
| Flash Point | 224.9ºC |
| Exact Mass | 219.08300 |
| PSA | 85.93000 |
| LogP | 2.63480 |
| Index of Refraction | 1.727 |
| InChIKey | HRBGONPRSGPFMT-UHFFFAOYSA-N |
| SMILES | NC(=S)NCCc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~98%
2-(1H-INDOL-3-Y... CAS#:312751-53-4 |
| Literature: Sireen AG Patent: EP1555264 A1, 2005 ; Location in patent: Page/Page column 14 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |