4-ALLYL-5-(4-TERT-BUTYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-ALLYL-5-(4-TERT-BUTYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 312290-54-3 | Molecular Weight | 273.39600 | |
| Density | 1.1g/cm3 | Boiling Point | 349.4ºC at 760 mmHg | |
| Molecular Formula | C15H19N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | 3-(4-tert-butylphenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 349.4ºC at 760 mmHg |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.39600 |
| Flash Point | 165.1ºC |
| Exact Mass | 273.13000 |
| PSA | 65.70000 |
| LogP | 4.09120 |
| Index of Refraction | 1.59 |
| InChIKey | DWHZDECQMUUDJV-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2ccc(C(C)(C)C)cc2)n[nH]c1=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |