tris(o-phenylenedioxy)spirocyclotriphosphazene structure
|
Common Name | tris(o-phenylenedioxy)spirocyclotriphosphazene | ||
|---|---|---|---|---|
| CAS Number | 311-03-5 | Molecular Weight | 459.22600 | |
| Density | 1.93g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H12N3O6P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(o-phenylenedioxy)spirocyclotriphosphazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.93g/cm3 |
|---|---|
| Molecular Formula | C18H12N3O6P3 |
| Molecular Weight | 459.22600 |
| Exact Mass | 458.99400 |
| PSA | 121.89000 |
| LogP | 5.55960 |
| Index of Refraction | 1.848 |
| InChIKey | XGNHEICZCRPVHP-UHFFFAOYSA-N |
| SMILES | c1ccc2c(c1)OP1(=NP3(=NP4(=N1)Oc1ccccc1O4)Oc1ccccc1O3)O2 |
|
~61%
tris(o-phenylen... CAS#:311-03-5 |
| Literature: Tian, Na-Na; Wang, Li-Sheng; Jiang, Ru-Yi Journal of Chemical and Engineering Data, 2011 , vol. 56, # 7 p. 3208 - 3213 |
|
~72%
tris(o-phenylen... CAS#:311-03-5 |
| Literature: Schroegel, Pamela; Hoping, Matthias; Kowalsky, Wolfgang; Hunze, Arvid; Wagenblast, Gerhard; Lennartz, Christian; Strohriegl, Peter Chemistry of Materials, 2011 , vol. 23, # 22 p. 4947 - 4953 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tris(o-phenylenedioxy)cyclotriphosphazene |
| tris(1,2-dioxyphenyl)cyclotriphosphazene |
| tris-o-phenylenedioxycyclotriphosphazene |
| tris(1,2-dioxyphenyl)-cyclotriphosphazene |
| tris-(1,2-dioxyphenyl)cyclotriphosphazene |
| tris-ortho-phenylenedioxycyclotriphosphazene |