2-Nitro-9-fluorenone structure
|
Common Name | 2-Nitro-9-fluorenone | ||
|---|---|---|---|---|
| CAS Number | 3096-52-4 | Molecular Weight | 225.200 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 419.0±24.0 °C at 760 mmHg | |
| Molecular Formula | C13H7NO3 | Melting Point | 222-223ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.1±15.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-nitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.0±24.0 °C at 760 mmHg |
| Melting Point | 222-223ºC(lit.) |
| Molecular Formula | C13H7NO3 |
| Molecular Weight | 225.200 |
| Flash Point | 215.1±15.7 °C |
| Exact Mass | 225.042587 |
| PSA | 62.89000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | AJEAHBZZHSLIQP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-c2ccc([N+](=O)[O-])cc21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S37/S39 |
| RIDADR | NONH for all modes of transport |
| RTECS | LL9091000 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Laser desorption/ionization time-of-flight mass spectrometry of nitrated polycyclic aromatic hydrocarbons.
Anal. Chem. 68(14) , 2319-24, (1996) Mass spectra of four nitrated polycyclic aromatic hydrocarbons (nitro-PAHs), 9-nitroanthracene, 1-nitropyrene, 2-nitro-9-fluorenone, and 2-nitrofluorene, have been investigated using single-step laser... |
|
|
2-Nitrofluorene and related compounds: prevalence and biological effects.
Mutat. Res. 196(2) , 177-209, (1988)
|
|
|
Voltammetric Determination of Genotoxic Nitro Derivatives of Fluorene and 9-Fluorenone Using a Mercury Meniscus Modified Silver Solid Amalgam Electrode. Vyskocil V, et al.
Electroanalysis 22(17-18) , 2034-2042, (2010)
|
| 2-Nitro-9H-fluoren-9-one |
| 9H-FLUOREN-9-ONE,2-NITRO |
| 2-nitro-9-ketofluorene |
| MFCD00001152 |
| 2-Nitrofluorenone |
| 2-Nitrofluorene-9-one |
| 2-Nitro-9-fluorenone |
| 9-Oxo-2-nitrofluorene |
| 9H-Fluoren-9-one, 2-nitro- |