N,N-Bis(2-hydroxyethyl)-3-(4-methoxyphenyl)propenamide structure
|
Common Name | N,N-Bis(2-hydroxyethyl)-3-(4-methoxyphenyl)propenamide | ||
|---|---|---|---|---|
| CAS Number | 30687-20-8 | Molecular Weight | 265.30500 | |
| Density | 1.206g/cm3 | Boiling Point | 536.5ºC at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | (E)-N,N-bis(2-hydroxyethyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 536.5ºC at 760 mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.30500 |
| Flash Point | 278.3ºC |
| Exact Mass | 265.13100 |
| PSA | 70.00000 |
| LogP | 0.52160 |
| Index of Refraction | 1.589 |
| InChIKey | ZOEUMARXBZTMSR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=CC(=O)N(CCO)CCO)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |