2-benzamido-4-methylsulfinylbutanoic acid structure
|
Common Name | 2-benzamido-4-methylsulfinylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3054-52-2 | Molecular Weight | 269.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzamido-4-methylsulfinylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO4S |
|---|---|
| Molecular Weight | 269.31700 |
| Exact Mass | 269.07200 |
| PSA | 106.17000 |
| LogP | 2.07870 |
| InChIKey | RGQMMJWJMMNPLS-UHFFFAOYSA-N |
| SMILES | CS(=O)CCC(NC(=O)c1ccccc1)C(=O)O |
|
~%
2-benzamido-4-m... CAS#:3054-52-2 |
| Literature: Morihara,K. Bulletin of the Chemical Society of Japan, 1964 , vol. 37, p. 1787 - 1794 |
|
~%
2-benzamido-4-m... CAS#:3054-52-2 |
| Literature: Krishna Kishore; Kalyan Kumar; Annapurna; Vani Journal of the Indian Chemical Society, 2007 , vol. 84, # 4 p. 373 - 377 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzoyl-L-methioninsulfoxid |
| N-Benzoyl-Derivat des Methionin-S-oxid |
| N-benzoyl L-methionine sulphoxide |
| N-benzoyl derivative of methionine S-oxide |