[(2-benzamido-4-methylpentanoyl)amino] benzoate structure
|
Common Name | [(2-benzamido-4-methylpentanoyl)amino] benzoate | ||
|---|---|---|---|---|
| CAS Number | 3369-50-4 | Molecular Weight | 354.40000 | |
| Density | 1.176g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2-benzamido-4-methylpentanoyl)amino] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.40000 |
| Exact Mass | 354.15800 |
| PSA | 91.48000 |
| LogP | 4.13440 |
| Index of Refraction | 1.563 |
| InChIKey | FUSCRTKCQYGJDN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)C(=O)NOC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
[(2-benzamido-4... CAS#:3369-50-4 |
| Literature: Wieland; Fritz Chemische Berichte, 1953 , vol. 86, p. 1186,1195 |
|
~%
[(2-benzamido-4... CAS#:3369-50-4 |
| Literature: Wieland; Fritz Chemische Berichte, 1953 , vol. 86, p. 1186,1195 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzoyl-leucine benzoyloxyamide |
| 4,5,6,7-Tetrahydro-2-o-tolyl-4-benzothiazolecarboxylic acid |
| 4-Benzothiazolecarboxylic acid,4,5,6,7-tetrahydro-2-o-tolyl |
| o-Tolyl-2 carboxy-4 tetrahydro-4,5,6,7 benzothiazole |
| N-Benzoyl-leucin-benzoyloxyamid |