4-ETHYL-5-M-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL structure
|
Common Name | 4-ETHYL-5-M-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 305337-12-6 | Molecular Weight | 219.30600 | |
| Density | 1.21g/cm3 | Boiling Point | 311.8ºC at 760mmHg | |
| Molecular Formula | C11H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.4ºC | |
| Name | 4-ethyl-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 311.8ºC at 760mmHg |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.30600 |
| Flash Point | 142.4ºC |
| Exact Mass | 219.08300 |
| PSA | 69.51000 |
| LogP | 2.56210 |
| Index of Refraction | 1.644 |
| InChIKey | DWIGEOFJARIEDR-UHFFFAOYSA-N |
| SMILES | CCn1c(-c2cccc(C)c2)n[nH]c1=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-ethyl-5-(3-methylphenyl)-1,2,4-triazole-3-thiol |
| 4-ethyl-5-(3-methylphenyl)-4H-1,2,4-triazole-3-thiol |
| 4-Ethyl-5-m-tolyl-4H-[1,2,4]triazole-3-thiol |