1,4-phenylene bismethacrylate
Modify Date: 2024-01-10 22:21:51
1,4-phenylene bismethacrylate structure
|
Common Name | 1,4-phenylene bismethacrylate | ||
|---|---|---|---|---|
| CAS Number | 3049-31-8 | Molecular Weight | 246.25900 | |
| Density | 1.116g/cm3 | Boiling Point | 377.3ºC at 760mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 188.5ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | [4-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 377.3ºC at 760mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 188.5ºC |
| Exact Mass | 246.08900 |
| PSA | 52.60000 |
| LogP | 2.64960 |
| Index of Refraction | 1.515 |
| InChIKey | MDMKOESKPAVFJF-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc(OC(=O)C(=C)C)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335-H411 |
| Precautionary Statements | P273-P280-P305 + P351 + P338-P333 + P313-P391-P501 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
|
~98%
1,4-phenylene b... CAS#:3049-31-8 |
| Literature: TRUSTEES OF BOSTON UNIVERSITY; THE BRIGHAM AND WOMEN'S HOSPITAL, INC.; GRINSTAFF, Mark, W.; COLBY, Aaron, H.; COLSON, Yolonda Patent: WO2013/59295 A2, 2013 ; Location in patent: Paragraph 00209 ; |
|
~81%
1,4-phenylene b... CAS#:3049-31-8 |
| Literature: Goh, Tor Kit; Blencowe, Anton; Tan, Jing Fung; Coventry, Kristopher D.; Qian, Feng; Tachasirinugune, Tatchkul; Qiao, Greg G. Australian Journal of Chemistry, 2009 , vol. 62, # 8 p. 891 - 898 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-Bis-methacryloyloxy-benzol |
| EINECS 221-262-4 |
| 1,4-Phenylene dimethacrylate |
| 1,4-phenylene bismethacrylate |
| 1,4-bis-methacryloyloxy-benzene |
| 1,4-Phenylendimethacrylat |