2-(3-nitrophenyl)-1,3,5-triazine
Modify Date: 2025-09-26 19:11:08
2-(3-nitrophenyl)-1,3,5-triazine structure
|
Common Name | 2-(3-nitrophenyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 30361-90-1 | Molecular Weight | 202.17000 | |
| Density | 1.382g/cm3 | Boiling Point | 430.1ºC at 760mmHg | |
| Molecular Formula | C9H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 2-(3-nitrophenyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760mmHg |
| Molecular Formula | C9H6N4O2 |
| Molecular Weight | 202.17000 |
| Flash Point | 213.9ºC |
| Exact Mass | 202.04900 |
| PSA | 84.49000 |
| LogP | 1.97000 |
| Index of Refraction | 1.624 |
| InChIKey | YTTCADSUCSNMQI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ncncn2)c1 |
|
~%
2-(3-nitropheny... CAS#:30361-90-1 |
| Literature: Schaefer; Peters Journal of the American Chemical Society, 1959 , vol. 81, p. 1470,1473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-<3-Nitro-phenyl>-1,3,5-triazin |
| 2-<3-Nitro-phenyl>-s-triazin |