Serotonin hydrogenoxalate
Modify Date: 2025-08-23 18:25:26
Serotonin hydrogenoxalate structure
|
Common Name | Serotonin hydrogenoxalate | ||
|---|---|---|---|---|
| CAS Number | 3036-16-6 | Molecular Weight | 266.25000 | |
| Density | N/A | Boiling Point | 416.1ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O5 | Melting Point | 195-200ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 205.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Serotonin hydrogenoxalate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.1ºC at 760 mmHg |
|---|---|
| Melting Point | 195-200ºC (dec.) |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25000 |
| Flash Point | 205.4ºC |
| Exact Mass | 266.09000 |
| PSA | 136.64000 |
| LogP | 1.23060 |
| InChIKey | VTBOICJSERLVPD-UHFFFAOYSA-N |
| SMILES | NCCc1c[nH]c2ccc(O)cc12.O=C(O)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 |
| Precautionary Statements | P280-P301 + P312 + P330 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 21/22 |
| Safety Phrases | 24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Control of catecholamine and serotonin release from the chromaffin tissue of the Atlantic hagfish
J. Exp. Biol. 199(Pt 11) , 2485-97, (1996) An in situ saline-perfused systemic heart/posterior cardinal vein preparation of the Atlantic hagfish (Myxine glutinosa) was used to assess (1) the ability of the chromaffin tissue to release catechol... |
| MFCD00043257 |
| 5-HYDROXYTRYPTAMINE OXALATE SALT |
| 3-(2-Aminoethyl)-5-hydroxyindole hydrogenoxalate,5-HT,5-Hydroxytryptamine hydrogenoxalate |
| EINECS 221-233-6 |