AURORA 15361
Modify Date: 2025-08-25 10:41:28
AURORA 15361 structure
|
Common Name | AURORA 15361 | ||
|---|---|---|---|---|
| CAS Number | 302952-79-0 | Molecular Weight | 352.26100 | |
| Density | 1.479g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C17H11F3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | 7-hydroxy-3-(4-methoxyphenoxy)-2-(trifluoromethyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C17H11F3O5 |
| Molecular Weight | 352.26100 |
| Flash Point | 211.7ºC |
| Exact Mass | 352.05600 |
| PSA | 68.90000 |
| LogP | 4.31830 |
| Index of Refraction | 1.581 |
| InChIKey | LKMQUOUQJOAPMU-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2c(C(F)(F)F)oc3cc(O)ccc3c2=O)cc1 |
| HS Code | 2932999099 |
|---|
|
~94%
AURORA 15361 CAS#:302952-79-0 |
| Literature: PROTEOLOGICS LTD; NAKACHE, Philippe Patent: WO2010/134082 A1, 2010 ; Location in patent: Page/Page column 15; 16 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-hydroxy-3-(4-methoxyphenoxy)-2-(trifluoromethyl)-4H-chromen-4-one |