TERT-BUTYL 6-OXO-2 3-DIPHENYL-4- structure
|
Common Name | TERT-BUTYL 6-OXO-2 3-DIPHENYL-4- | ||
|---|---|---|---|---|
| CAS Number | 302911-78-0 | Molecular Weight | 353.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23NO4 | Melting Point | 191-193ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl 6-oxo-2,3-diphenylmorpholine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 191-193ºC(lit.) |
|---|---|
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.41200 |
| Exact Mass | 353.16300 |
| PSA | 55.84000 |
| LogP | 4.20080 |
| InChIKey | MRUKRSQUUNYOFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)OC(c2ccccc2)C1c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
|
Asymmetric syntheses of unnatural amino acids and hydroxyethylene Peptide isosteres.
Methods Mol. Med. 23 , 339-56, (1999) Unnatural and naturally occurring nonproteinogenic α-amino acids have become important building blocks for the synthesis of biologically active peptides and peptidomimetic drug molecules. The asymmetr... |
| MFCD00074954 |
| tert-Butyl 6-oxo-2,3-diphenyl-4-morpholinecarboxylate |