Ro01-6128 structure
|
Common Name | Ro01-6128 | ||
|---|---|---|---|---|
| CAS Number | 302841-86-7 | Molecular Weight | 283.322 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ro01-6128Ro 01-6128 is a positive allosteric modulator of mGluR1[1]. |
| Name | Ro 01-6128 |
|---|---|
| Synonym | More Synonyms |
| Description | Ro 01-6128 is a positive allosteric modulator of mGluR1[1]. |
|---|---|
| Related Catalog | |
| Target |
mGluR 1 |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.322 |
| Exact Mass | 283.120850 |
| PSA | 55.40000 |
| LogP | 3.38 |
| Index of Refraction | 1.562 |
| InChIKey | ILSZPWZFQHSKLW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=O)C(c1ccccc1)c1ccccc1 |
| Ethyl (diphenylacetyl)carbamate |
| Ro01-6128 |
| Carbamic acid, N-(2,2-diphenylacetyl)-, ethyl ester |