Fluacizine structure
|
Common Name | Fluacizine | ||
|---|---|---|---|---|
| CAS Number | 30223-48-4 | Molecular Weight | 394.45400 | |
| Density | 1.267g/cm3 | Boiling Point | 528.6ºC at 760mmHg | |
| Molecular Formula | C20H21F3N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.5ºC | |
| Name | 3-(Diethylamino)-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]-1 -propanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 528.6ºC at 760mmHg |
| Molecular Formula | C20H21F3N2OS |
| Molecular Weight | 394.45400 |
| Flash Point | 273.5ºC |
| Exact Mass | 394.13300 |
| PSA | 48.85000 |
| LogP | 5.63160 |
| Index of Refraction | 1.569 |
| InChIKey | VHEOUJNDDFHPGJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(=O)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| RIDADR | UN 3249 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2934300000 |
|
~%
Fluacizine CAS#:30223-48-4 |
| Literature: Gritsenko,A.N. et al. Pharmaceutical Chemistry Journal, 1971 , vol. 5, p. 330 - 333 Khimiko-Farmatsevticheskii Zhurnal, 1971 , vol. 5, # 6 p. 18 - 20 |
|
~%
Fluacizine CAS#:30223-48-4 |
| Literature: Gritsenko,A.N. et al. Pharmaceutical Chemistry Journal, 1971 , vol. 5, p. 330 - 333 Khimiko-Farmatsevticheskii Zhurnal, 1971 , vol. 5, # 6 p. 18 - 20 |
|
~%
Fluacizine CAS#:30223-48-4 |
| Literature: Gritsenko,A.N. et al. Pharmaceutical Chemistry Journal, 1971 , vol. 5, p. 330 - 333 Khimiko-Farmatsevticheskii Zhurnal, 1971 , vol. 5, # 6 p. 18 - 20 |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| phtaloyl-triglycil ethyl ester |
| fluoracizine |
| phth-gly-gly-gly-OEt |
| Thalinil |
| Fluoracizin |
| N-[N-(N,N-Phthaloyl-glycyl)-glycyl]-glycin-aethylester |
| Phtalazol |
| Ftalazol |
| N-(4-thiazol-2-ylsulfamoyl-phenyl)-phthalamic acid |
| 2-[({4-[(2-thiazolylamino)sulfonyl]phenyl}amino)carbonyl]-benzoic acid |
| Sulftalyl |
| PST |
| Taloudron |
| N-(4-Thiazol-2-ylsulfamoyl-phenyl)-phthalamidsaeure |
| Phthaloyl-glycyl-glycyl-glycin-ethylester |
| Taleudron |
| Ftalysept |
| Talidine |
| Phthoracizin |
| Cremothalidine |
| N-[N-(N,N-phthaloyl-glycyl)-glycyl]-glycine ethyl ester |
| entexidin |
| N-Phthaloylacetyl-glycyl-glycin-ethylester |