CL-407669
Modify Date: 2024-04-03 16:45:32
CL-407669 structure
|
Common Name | CL-407669 | ||
|---|---|---|---|---|
| CAS Number | 301195-27-7 | Molecular Weight | 333.43 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H27N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CL-407669diuretic activity diuretic activity |
| Name | CL-407669 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.43 |
| Exact Mass | 333.216461 |
| LogP | 2.81 |
| Index of Refraction | 1.645 |
| InChIKey | NOHQTJXYOGGAKZ-UHFFFAOYSA-N |
| SMILES | CCCCCCn1c(N2CCCCC2)nc2c1c(=O)[nH]c(=O)n2C |
| 2H-purin-2-one, 7-hexyl-3,7-dihydro-6-hydroxy-3-methyl-8-(1-piperidinyl)- |
| 7-hexyl-3-methyl-8-(piperidin-1-yl)-3,7-dihydro-1H-purine-2,6-dione |
| 1H-Purine-2,6-dione, 7-hexyl-3,7-dihydro-3-methyl-8-(1-piperidinyl)- |
| 7-Hexyl-3-methyl-8-(1-piperidinyl)-3,7-dihydro-1H-purine-2,6-dione |