4-Amino-3,5-dibromo-2'-bromo-acetophenone structure
|
Common Name | 4-Amino-3,5-dibromo-2'-bromo-acetophenone | ||
|---|---|---|---|---|
| CAS Number | 30095-55-7 | Molecular Weight | 371.85100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Br3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Amino-3,5-dibromophenyl)-2-bromoethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6Br3NO |
|---|---|
| Molecular Weight | 371.85100 |
| Exact Mass | 368.80000 |
| PSA | 43.09000 |
| LogP | 3.95260 |
| InChIKey | HAMHABGUPISDGT-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(C(=O)CBr)cc1Br |
| HS Code | 2922399090 |
|---|
|
~56%
4-Amino-3,5-dib... CAS#:30095-55-7 |
| Literature: Ruzafa, Santiago Conde; Gil, Ana Martinez; Perez Fernandez, Daniel Ignacio; Perez Martin, Maria Concepcion; Moreno Munoz, Francisco Jose; Jurado, Francisco Wandosell Patent: US2003/199508 A1, 2003 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-3,5-dibrom-phenacylbromid,2,3',5'-Tribrom-4'-amino-acetophenon |
| 1-(4-Amino-3,5-dibromo-phenyl)-2-bromo-ethanone |
| 4'-amino-2,3',5'-tribromoacetophenone |
| Ethanone,1-(4-amino-3,5-dibromophenyl)-2-bromo |
| 4-amino-3,5-dibromophenacyl bromide |
| 2,3',5'-Tribrom-4'-Amino-Acetophenon |