Boc-Asn-ol structure
|
Common Name | Boc-Asn-ol | ||
|---|---|---|---|---|
| CAS Number | 30044-67-8 | Molecular Weight | 218.25000 | |
| Density | 1.16g/cm3 | Boiling Point | 456.4ºC at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.8ºC | |
| Name | tert-butyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 456.4ºC at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25000 |
| Flash Point | 229.8ºC |
| Exact Mass | 218.12700 |
| PSA | 101.65000 |
| LogP | 0.83860 |
| Index of Refraction | 1.487 |
| InChIKey | BYCKHNZSBNGBQL-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)CC(N)=O |
| Storage condition | Store at 0°C |
|
~%
Boc-Asn-ol CAS#:30044-67-8 |
| Literature: Journal of medicinal chemistry, , vol. 13, # 6 p. 1095 - 1098 |
|
~%
Boc-Asn-ol CAS#:30044-67-8 |
| Literature: Journal of Antibiotics, , vol. 48, # 9 p. 1004 - 1010 |
|
~%
Boc-Asn-ol CAS#:30044-67-8 |
| Literature: Journal of Antibiotics, , vol. 48, # 9 p. 1004 - 1010 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L(-)-tert.Butoxycarboxamido-4-hydroxybutyramid |
| (S)-3-(Boc-amino)-4-hydroxybutyramide |
| Boc-Asn-ol |
| (S)-tert-Butyl (4-amino-1-hydroxy-4-oxobutan-2-yl)carbamate |
| L-t-Boc-Asnol |