AKOS B013829
Modify Date: 2025-09-24 13:50:16
AKOS B013829 structure
|
Common Name | AKOS B013829 | ||
|---|---|---|---|---|
| CAS Number | 30033-94-4 | Molecular Weight | 214.64600 | |
| Density | 1.265g/cm3 | Boiling Point | 338.4ºC at 760 mmHg | |
| Molecular Formula | C10H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | 2-(2-chloro-5-methylphenoxy)propanoic acid |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 338.4ºC at 760 mmHg |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.64600 |
| Flash Point | 158.5ºC |
| Exact Mass | 214.04000 |
| PSA | 46.53000 |
| LogP | 2.50030 |
| Index of Refraction | 1.542 |
| InChIKey | FYAUPTBCTGCOAA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(OC(C)C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |