Naled structure
|
Common Name | Naled | ||
|---|---|---|---|---|
| CAS Number | 300-76-5 | Molecular Weight | 380.784 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 273.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C4H7Br2Cl2O4P | Melting Point | 26.5-27.5ºC | |
| MSDS | Chinese USA | Flash Point | 119.4±27.3 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of NaledNaled is an organophosphate cholinesterase inhibitor that is used as an insecticide and as an acaricide. |
| Name | naled |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.8±40.0 °C at 760 mmHg |
| Melting Point | 26.5-27.5ºC |
| Molecular Formula | C4H7Br2Cl2O4P |
| Molecular Weight | 380.784 |
| Flash Point | 119.4±27.3 °C |
| Exact Mass | 377.782562 |
| PSA | 54.57000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | BUYMVQAILCEWRR-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)OC(Br)C(Cl)(Cl)Br |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H400 |
| Precautionary Statements | P273-P301 + P310 + P330-P302 + P352 + P312-P305 + P351 + P338-P337 + P313-P391 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,N,T |
| Risk Phrases | R21/22 |
| Safety Phrases | 36/37-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TB9450000 |
| Packaging Group | I |
| HS Code | 2919900090 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Mosquito control insecticides: a probabilistic ecological risk assessment on drift exposures of naled, dichlorvos (naled metabolite) and permethrin to adult butterflies.
Sci. Total Environ. 502 , 252-65, (2015) A comprehensive probabilistic terrestrial ecological risk assessment (ERA) was conducted to characterize the potential risk of mosquito control insecticide (i.e., naled, it's metabolite dichlorvos, an... |
|
|
Human exposure to mosquito-control pesticides--Mississippi, North Carolina, and Virginia, 2002 and 2003.
MMWR Morb. Mortal. Wkly. Rep. 54(21) , 529-32, (2005) Public health officials weigh the risk for mosquito-borne diseases against the risk for human exposure to pesticides sprayed to control mosquitoes. Response to outbreaks of mosquito-borne diseases has... |
|
|
Efficacy of Dibrom, Trumpet, and Scourge against four mosquito species in Louisiana.
J. Am. Mosq. Control Assoc. 15(4) , 433-6, (1999) Adult mortality of Anopheles quadrimaculatus, Culex quinquefasciatus, and the Aedes spp. complex (Aedes sollicitans and Aedes taeniorhynchus) was observed after aerial ultra-low volume (ULV) exposure ... |
| Naled |
| BRP |
| EINECS 206-098-3 |
| 1,2-Dibromo-2,2-dichloroethyl dimethyl phosphate |
| (1,2-Dibromo-2,2-dichloroethyl) dimethyl phosphate,Bromchlophos,Naled |
| Dibrom |
| 1,2-dibromo-2,2-dichloro-ethyl dimethyl phosphate |
| (RS)-1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
| Arthodibrom |
| Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
| MFCD00053227 |
| Ortho-Dibrom |
| rac-(1R)-1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
| Orthodibromo |
| phosphoric acid 1,2-dibromo-2,2-dichloro-ethyl ester dimethyl ester |
| Dibromfos |
| fosforan |
| Phosphoric acid 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
| Fosbrom |
| BROMCHLOPHOS |
| Bromex |
| (1,2-dibromo-2,2-dichloroethyl) dimethyl phosphate |