ROS-IN-1
Modify Date: 2025-09-11 11:11:39
ROS-IN-1 structure
|
Common Name | ROS-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 298193-11-0 | Molecular Weight | 267.34 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 411.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8±31.5 °C | |
Use of ROS-IN-1ROS-IN-1 is a mitochondrial ROS inhibitor. ROS-IN-1 can reduce oxidative stress or inhibit reactive oxygen species (ROS) production[1]. |
| Name | WAY-320049 |
|---|---|
| Synonym | More Synonyms |
| Description | ROS-IN-1 is a mitochondrial ROS inhibitor. ROS-IN-1 can reduce oxidative stress or inhibit reactive oxygen species (ROS) production[1]. |
|---|---|
| Related Catalog | |
| In Vitro | ROS-IN-1 (Compound 40) 可以减少 ROS 的产生 (25.1%)[1]。 |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.8±55.0 °C at 760 mmHg |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.34 |
| Flash Point | 202.8±31.5 °C |
| Exact Mass | 267.092926 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | UVXZHJFRFIKQMT-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2=O)c(C)c1 |
| 2-Pyrrolidinone, 1-[(2,4,6-trimethylphenyl)sulfonyl]- |
| 1-(2,4,6-Trimethyl-benzenesulfonyl)-pyrrolidin-2-one |
| 1-(Mesitylsulfonyl)pyrrolidin-2-one |
| 1-(Mesitylsulfonyl)-2-pyrrolidinone |