trifluoromethanesulfonic acid-1H-imidazole (1:1) structure
|
Common Name | trifluoromethanesulfonic acid-1H-imidazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 29727-06-8 | Molecular Weight | 218.15400 | |
| Density | N/A | Boiling Point | 162ºC at 760 mmHg | |
| Molecular Formula | C4H5F3N2O3S | Melting Point | 189-193ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1H-imidazole,trifluoromethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 162ºC at 760 mmHg |
|---|---|
| Melting Point | 189-193ºC(lit.) |
| Molecular Formula | C4H5F3N2O3S |
| Molecular Weight | 218.15400 |
| Flash Point | 185.8ºC |
| Exact Mass | 217.99700 |
| PSA | 91.43000 |
| LogP | 1.88450 |
| Vapour Pressure | 1.14mmHg at 25°C |
| InChIKey | JNJFONBBNLVENC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(F)(F)F.c1c[nH]cn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Benzimidazolium triflate-activated synthesis of (6-4) photoproduct-containing oligonucleotides and its application.
Nucleic Acids Res. 27(11) , 2299-303, (1999) In the solid-phase synthesis of oligonucleotides containing the pyrimidine(6-4)pyrimidone photoproduct using a dinucleotide building block, considerable amounts of by-products were found as the chain ... |
|
|
Synthesis and aminoacyl-tRNA synthetase inhibitory activity of aspartyl adenylate analogs.
Bioorg. Med. Chem. 13(1) , 69-75, (2005) Three nonhydrolyzable aspartyl adenylate analogs have been prepared and tested as inhibitors of E. coli aspartyl-tRNA synthetase. 5'-O-[N-(L-Aspartyl)sulfamoyl]adenosine is a potent competitive inhibi... |
| Imidazole trifluoromethanesulfonate salt |
| imidazole triflate |
| imidazolium trifluoromethanesulfonate |
| MFCD00035430 |
| Imidazole trifluoromethanesulfonate |
| Imidazolium triflate |