1-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one
Modify Date: 2025-08-25 16:19:46
1-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 2965-64-2 | Molecular Weight | 256.27200 | |
| Density | 1.175g/cm3 | Boiling Point | 407.7ºC at 760 mmHg | |
| Molecular Formula | C16H13FO2 | Melting Point | 107-108ºC | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | 4-methoxy-4'-fluorochalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760 mmHg |
| Melting Point | 107-108ºC |
| Molecular Formula | C16H13FO2 |
| Molecular Weight | 256.27200 |
| Flash Point | 193.4ºC |
| Exact Mass | 256.09000 |
| PSA | 26.30000 |
| LogP | 3.73040 |
| Vapour Pressure | 7.4E-07mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | AOINTYAZKYYNGN-NYYWCZLTSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccc(F)cc2)cc1 |
|
~78%
1-(4-fluorophen... CAS#:2965-64-2 |
| Literature: Bhat; Shenoy Pharmacy and Pharmacology Communications, 2000 , vol. 6, # 12 p. 553 - 557 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| p-fluorophenyl 3-(p-methoxyphenyl)-2-propenyl ketone |
| 3-(4-methoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| 1-(4-fluorophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| MFCD00017964 |
| 4'-FLUORO-4-METHOXYCHALCONE |