LUCENIN-2 structure
|
Common Name | LUCENIN-2 | ||
|---|---|---|---|---|
| CAS Number | 29428-58-8 | Molecular Weight | 610.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LUCENIN-2Lucenin-2 is a natural C-glucoside compound belonging to the flavonoid class[1]. |
| Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Lucenin-2 is a natural C-glucoside compound belonging to the flavonoid class[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H30O16 |
|---|---|
| Molecular Weight | 610.52 |
| Exact Mass | 610.15300 |
| PSA | 291.43000 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | ZLPSOQFIIQIIAX-VQVVXJKKSA-N |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c(C3OC(CO)C(O)C(O)C3O)c(O)c(C3OC(CO)C(O)C(O)C3O)c(O)c12 |
| Lucenin-2 |
| Luteolin 6,8-di-C-glucoside |